Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
4,5-Dihydroxynaphthalene-2,7-disulfonic Acid, Disodium Salt Dihydrate, 98%
CAS: 5808-22-0 Molecular Formula: C10H10Na2O10S2 Molecular Weight (g/mol): 400.28 MDL Number: MFCD00150612 InChI Key: QUEAKWJKJBFNEG-UHFFFAOYSA-L Synonym: chromotropic acid sodium salt,4,5-dihydroxy-2,7-naphthalenedisulfonate,di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid,4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g PubChem CID: 124202444 IUPAC Name: 2,7-disodium 4,5-dihydroxynaphthalene-2,7-disulfonate dihydrate SMILES: O.O.OC1=CC(=CC2=CC(=CC(O)=C12)S(=O)(=O)O[Na])S(=O)(=O)O[Na]
| PubChem CID | 124202444 |
|---|---|
| CAS | 5808-22-0 |
| Molecular Weight (g/mol) | 400.28 |
| MDL Number | MFCD00150612 |
| SMILES | O.O.OC1=CC(=CC2=CC(=CC(O)=C12)S(=O)(=O)O[Na])S(=O)(=O)O[Na] |
| Synonym | chromotropic acid sodium salt,4,5-dihydroxy-2,7-naphthalenedisulfonate,di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid,4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g |
| IUPAC Name | 2,7-disodium 4,5-dihydroxynaphthalene-2,7-disulfonate dihydrate |
| InChI Key | QUEAKWJKJBFNEG-UHFFFAOYSA-L |
| Molecular Formula | C10H10Na2O10S2 |
beta-Glycerophosphate, 200mM soln.
CAS: 819-83-0 Molecular Formula: C3H7Na2O6P Molecular Weight (g/mol): 216.04 MDL Number: MFCD00002135 MFCD28134611 MFCD00149083 MFCD00150339 MFCD00002135 InChI Key: AVPCPPOOQICIRJ-UHFFFAOYSA-L Synonym: glycerol 2-phosphate disodium salt hydrate,disodium glycerol 2-phosphate hydrate,beta-glycerophosphoric acid disodium salt,c3h7o6p.2na.h2o,sodium glycerophosphate usan,b-glycerophosphate disodium salt hydrate,sodium 1,3-dihydroxypropan-2-yl phosphate hydrate 2:1:x,beta-glycerophosphate disodium salt hydrate, ≤1.0 mol % l-alpha-isomer,beta-glycerophosphate disodium salt hydrate, powder, bioreagent, suitable for cell culture,beta-glycerophosphate disodium salt hydrate, ≤2.4 mol % alpha-isomer based on c3h7o6pna2 with x h2o PubChem CID: 131860121 IUPAC Name: disodium 2-(phosphonatooxy)propane-1,3-diol SMILES: [Na+].[Na+].OCC(CO)OP([O-])([O-])=O
| PubChem CID | 131860121 |
|---|---|
| CAS | 819-83-0 |
| Molecular Weight (g/mol) | 216.04 |
| MDL Number | MFCD00002135 MFCD28134611 MFCD00149083 MFCD00150339 MFCD00002135 |
| SMILES | [Na+].[Na+].OCC(CO)OP([O-])([O-])=O |
| Synonym | glycerol 2-phosphate disodium salt hydrate,disodium glycerol 2-phosphate hydrate,beta-glycerophosphoric acid disodium salt,c3h7o6p.2na.h2o,sodium glycerophosphate usan,b-glycerophosphate disodium salt hydrate,sodium 1,3-dihydroxypropan-2-yl phosphate hydrate 2:1:x,beta-glycerophosphate disodium salt hydrate, ≤1.0 mol % l-alpha-isomer,beta-glycerophosphate disodium salt hydrate, powder, bioreagent, suitable for cell culture,beta-glycerophosphate disodium salt hydrate, ≤2.4 mol % alpha-isomer based on c3h7o6pna2 with x h2o |
| IUPAC Name | disodium 2-(phosphonatooxy)propane-1,3-diol |
| InChI Key | AVPCPPOOQICIRJ-UHFFFAOYSA-L |
| Molecular Formula | C3H7Na2O6P |
2,2-Diphenylethanol, 97%
CAS: 1883-32-5 Molecular Formula: C14H14O Molecular Weight (g/mol): 198.26 MDL Number: MFCD00004729 InChI Key: NYLOEXLAXYHOHH-UHFFFAOYSA-N Synonym: beta-phenylphenethyl alcohol,2,2-diphenyl ethanol,benzeneethanol, .beta.-phenyl,acmc-20aojg,2,2-diphenyl-ethanol,2,2-diphenyl-1-ethanol,2,2-diphenylethan-1-ol,benzeneethanol, b-phenyl,2,2-diphenylethanol,ksc539o6l PubChem CID: 74662 IUPAC Name: 2,2-diphenylethanol SMILES: C1=CC=C(C=C1)C(CO)C2=CC=CC=C2
| PubChem CID | 74662 |
|---|---|
| CAS | 1883-32-5 |
| Molecular Weight (g/mol) | 198.26 |
| MDL Number | MFCD00004729 |
| SMILES | C1=CC=C(C=C1)C(CO)C2=CC=CC=C2 |
| Synonym | beta-phenylphenethyl alcohol,2,2-diphenyl ethanol,benzeneethanol, .beta.-phenyl,acmc-20aojg,2,2-diphenyl-ethanol,2,2-diphenyl-1-ethanol,2,2-diphenylethan-1-ol,benzeneethanol, b-phenyl,2,2-diphenylethanol,ksc539o6l |
| IUPAC Name | 2,2-diphenylethanol |
| InChI Key | NYLOEXLAXYHOHH-UHFFFAOYSA-N |
| Molecular Formula | C14H14O |
3-Iodobenzoic acid, 98%
CAS: 618-51-9 Molecular Formula: C7H5IO2 Molecular Weight (g/mol): 248.01 MDL Number: MFCD00002496 InChI Key: KVBWBCRPWVKFQT-UHFFFAOYSA-N Synonym: m-iodobenzoic acid,benzoic acid, 3-iodo,3-iodo-benzoic acid,benzoic acid, m-iodo,3-iodobenzoicacid,3-carboxyiodobenzene,3-iodo benzoic acid,pubchem3925,acmc-209mwv,meta-carboxy iodo-benzene PubChem CID: 12060 IUPAC Name: 3-iodobenzoic acid SMILES: C1=CC(=CC(=C1)I)C(=O)O
| PubChem CID | 12060 |
|---|---|
| CAS | 618-51-9 |
| Molecular Weight (g/mol) | 248.01 |
| MDL Number | MFCD00002496 |
| SMILES | C1=CC(=CC(=C1)I)C(=O)O |
| Synonym | m-iodobenzoic acid,benzoic acid, 3-iodo,3-iodo-benzoic acid,benzoic acid, m-iodo,3-iodobenzoicacid,3-carboxyiodobenzene,3-iodo benzoic acid,pubchem3925,acmc-209mwv,meta-carboxy iodo-benzene |
| IUPAC Name | 3-iodobenzoic acid |
| InChI Key | KVBWBCRPWVKFQT-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO2 |
2-Butanone oxime, 99%
CAS: 96-29-7 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00013935 InChI Key: WHIVNJATOVLWBW-SNAWJCMRSA-N Synonym: mek-oxime,butanone oxime,methyl ethyl ketone oxime,2-butanone oxime,ethyl methyl ketoxime,usaf ek-906,ethyl-methylketonoxim,unii-51yge935u9,2-butanone, oxime,methyl ethyl ketoxime PubChem CID: 5324276 IUPAC Name: (NZ)-N-butan-2-ylidenehydroxylamine SMILES: CC\C(C)=N\O
| PubChem CID | 5324276 |
|---|---|
| CAS | 96-29-7 |
| Molecular Weight (g/mol) | 87.12 |
| MDL Number | MFCD00013935 |
| SMILES | CC\C(C)=N\O |
| Synonym | mek-oxime,butanone oxime,methyl ethyl ketone oxime,2-butanone oxime,ethyl methyl ketoxime,usaf ek-906,ethyl-methylketonoxim,unii-51yge935u9,2-butanone, oxime,methyl ethyl ketoxime |
| IUPAC Name | (NZ)-N-butan-2-ylidenehydroxylamine |
| InChI Key | WHIVNJATOVLWBW-SNAWJCMRSA-N |
| Molecular Formula | C4H9NO |
Hexafluorobenzene, 99%
CAS: 392-56-3 Molecular Formula: C6F6 Molecular Weight (g/mol): 186.056 MDL Number: MFCD00000288 InChI Key: ZQBFAOFFOQMSGJ-UHFFFAOYSA-N Synonym: hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus PubChem CID: 9805 ChEBI: CHEBI:38589 IUPAC Name: 1,2,3,4,5,6-hexafluorobenzene SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)F
| PubChem CID | 9805 |
|---|---|
| CAS | 392-56-3 |
| Molecular Weight (g/mol) | 186.056 |
| ChEBI | CHEBI:38589 |
| MDL Number | MFCD00000288 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)F |
| Synonym | hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus |
| IUPAC Name | 1,2,3,4,5,6-hexafluorobenzene |
| InChI Key | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N |
| Molecular Formula | C6F6 |
Fluorene, 98+%
CAS: 86-73-7 Molecular Formula: C13H10 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00001111 InChI Key: NIHNNTQXNPWCJQ-UHFFFAOYSA-N Synonym: fluorene,diphenylenemethane,o-biphenylenemethane,2,3-benzindene,2,2'-methylenebiphenyl,o-biphenylmethane,methane, diphenylene,fluoren,fluorenyl radical,flourene PubChem CID: 6853 ChEBI: CHEBI:28266 IUPAC Name: 9H-fluorene SMILES: C1C2=CC=CC=C2C2=CC=CC=C12
| PubChem CID | 6853 |
|---|---|
| CAS | 86-73-7 |
| Molecular Weight (g/mol) | 166.22 |
| ChEBI | CHEBI:28266 |
| MDL Number | MFCD00001111 |
| SMILES | C1C2=CC=CC=C2C2=CC=CC=C12 |
| Synonym | fluorene,diphenylenemethane,o-biphenylenemethane,2,3-benzindene,2,2'-methylenebiphenyl,o-biphenylmethane,methane, diphenylene,fluoren,fluorenyl radical,flourene |
| IUPAC Name | 9H-fluorene |
| InChI Key | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| Molecular Formula | C13H10 |
Indole, 99+%
CAS: 120-72-9 MDL Number: MFCD00005607 InChI Key: SIKJAQJRHWYJAI-UHFFFAOYSA-N Synonym: indole,indol,2,3-benzopyrrole,1-benzazole,ketole,1-azaindene,benzopyrrole,2,3-benzopyrole,caswell no. 498b,indol german PubChem CID: 798 ChEBI: CHEBI:16881 IUPAC Name: 1H-indole SMILES: C1=CC=C2C(=C1)C=CN2
| PubChem CID | 798 |
|---|---|
| CAS | 120-72-9 |
| ChEBI | CHEBI:16881 |
| MDL Number | MFCD00005607 |
| SMILES | C1=CC=C2C(=C1)C=CN2 |
| Synonym | indole,indol,2,3-benzopyrrole,1-benzazole,ketole,1-azaindene,benzopyrrole,2,3-benzopyrole,caswell no. 498b,indol german |
| IUPAC Name | 1H-indole |
| InChI Key | SIKJAQJRHWYJAI-UHFFFAOYSA-N |
1,3-Dioxolane, 99.8%, anhydrous, stabilized with 75 ppm BHT, AcroSeal™
CAS: 646-06-0 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 InChI Key: WNXJIVFYUVYPPR-UHFFFAOYSA-N Synonym: dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech PubChem CID: 31404 ChEBI: CHEBI:34247 IUPAC Name: 2,6-ditert-butyl-4-methylphenol SMILES: CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 31404 |
|---|---|
| CAS | 646-06-0 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:34247 |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Synonym | dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI Key | WNXJIVFYUVYPPR-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Carbon powder, activated, Norit GSX, steam activated, acid washed
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12.011 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12.011 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
(2-Hydroxyethyl)triphenylphosphonium bromide, 98+%
CAS: 7237-34-5 Molecular Formula: C20H20BrOP Molecular Weight (g/mol): 387.26 MDL Number: MFCD00011901 InChI Key: QZJOQNHOOVSESC-UHFFFAOYSA-M Synonym: 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 PubChem CID: 2733550 IUPAC Name: 2-hydroxyethyl(triphenyl)phosphanium;bromide SMILES: [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2733550 |
|---|---|
| CAS | 7237-34-5 |
| Molecular Weight (g/mol) | 387.26 |
| MDL Number | MFCD00011901 |
| SMILES | [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;bromide |
| InChI Key | QZJOQNHOOVSESC-UHFFFAOYSA-M |
| Molecular Formula | C20H20BrOP |
Methyltriphenylphosphonium chloride, 97%, Thermo Scientific Chemicals
CAS: 1031-15-8 Molecular Formula: C19H18ClP Molecular Weight (g/mol): 312.78 MDL Number: MFCD00797851 InChI Key: QRPRIOOKPZSVFN-UHFFFAOYSA-M Synonym: methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride PubChem CID: 9879809 IUPAC Name: methyl(triphenyl)phosphanium;chloride SMILES: [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9879809 |
|---|---|
| CAS | 1031-15-8 |
| Molecular Weight (g/mol) | 312.78 |
| MDL Number | MFCD00797851 |
| SMILES | [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride |
| IUPAC Name | methyl(triphenyl)phosphanium;chloride |
| InChI Key | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
| Molecular Formula | C19H18ClP |
6-Bromo-1-hexanol, 95%
CAS: 4286-55-9 Molecular Formula: C6H13BrO Molecular Weight (g/mol): 181.07 MDL Number: MFCD00002983 InChI Key: FCMCSZXRVWDVAW-UHFFFAOYSA-N Synonym: 6-bromo-1-hexanol,6-bromohexanol,1-hexanol, 6-bromo,6-bromo-hexan-1-ol,hexamethylene bromohydrin,6-bromo-hexanol,6-bromo-l-hexanol,1-bromo-6-hexanol,1-bromohexan-6-ol,6-hydroxyhexyl bromide PubChem CID: 77970 IUPAC Name: 6-bromohexan-1-ol SMILES: OCCCCCCBr
| PubChem CID | 77970 |
|---|---|
| CAS | 4286-55-9 |
| Molecular Weight (g/mol) | 181.07 |
| MDL Number | MFCD00002983 |
| SMILES | OCCCCCCBr |
| Synonym | 6-bromo-1-hexanol,6-bromohexanol,1-hexanol, 6-bromo,6-bromo-hexan-1-ol,hexamethylene bromohydrin,6-bromo-hexanol,6-bromo-l-hexanol,1-bromo-6-hexanol,1-bromohexan-6-ol,6-hydroxyhexyl bromide |
| IUPAC Name | 6-bromohexan-1-ol |
| InChI Key | FCMCSZXRVWDVAW-UHFFFAOYSA-N |
| Molecular Formula | C6H13BrO |
Thioacetic acid, 97%
CAS: 507-09-5 Molecular Formula: C2H4OS Molecular Weight (g/mol): 76.11 MDL Number: MFCD00004853 InChI Key: DUYAAUVXQSMXQP-UHFFFAOYSA-N Synonym: thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh PubChem CID: 10484 ChEBI: CHEBI:16555 IUPAC Name: ethanethioic S-acid SMILES: CC(S)=O
| PubChem CID | 10484 |
|---|---|
| CAS | 507-09-5 |
| Molecular Weight (g/mol) | 76.11 |
| ChEBI | CHEBI:16555 |
| MDL Number | MFCD00004853 |
| SMILES | CC(S)=O |
| Synonym | thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh |
| IUPAC Name | ethanethioic S-acid |
| InChI Key | DUYAAUVXQSMXQP-UHFFFAOYSA-N |
| Molecular Formula | C2H4OS |
9-Hydroxyfluorene, 97%
CAS: 1689-64-1 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 MDL Number: MFCD00001135 InChI Key: AFMVESZOYKHDBJ-UHFFFAOYSA-N Synonym: 9-hydroxyfluorene,9-fluorenol,fluoren-9-ol,fluorenol,9-hydroxy fluorene,diphenylene carbinol,unii-bv0q72r613,hydroxyfluoren,9-hydroxy-fluoren,9h-fluorene-9-ol PubChem CID: 74318 ChEBI: CHEBI:16904 IUPAC Name: 9H-fluoren-9-ol SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)O
| PubChem CID | 74318 |
|---|---|
| CAS | 1689-64-1 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:16904 |
| MDL Number | MFCD00001135 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)O |
| Synonym | 9-hydroxyfluorene,9-fluorenol,fluoren-9-ol,fluorenol,9-hydroxy fluorene,diphenylene carbinol,unii-bv0q72r613,hydroxyfluoren,9-hydroxy-fluoren,9h-fluorene-9-ol |
| IUPAC Name | 9H-fluoren-9-ol |
| InChI Key | AFMVESZOYKHDBJ-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |